C17H17F2NO — CID 63379238
N-[(2,5-difluorophenyl)methyl]-1-(2-prop-2-enoxyphenyl)methanamine (PubChem CID 63379238) has the molecular formula C17H17F2NO and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-1-(2-prop-2-enoxyphenyl)methanamine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-1-(2-prop-2-enoxyphenyl)methanamine |
|---|---|
| PubChem CID | 63379238 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-1-(2-prop-2-enoxyphenyl)methanamine |
| SMILES | C=CCOc1ccccc1CNCc1cc(F)ccc1F |
| InChI | InChI=1S/C17H17F2NO/c1-2-9-21-17-6-4-3-5-13(17)11-20-12-14-10-15(18)7-8-16(14)19/h2-8,10,20H,1,9,11-12H2 |
| InChIKey | KDBSLOFAMZLGLK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|