ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate

C11H12N2O4 — CID 63379548

IUPACethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate
SMILESCCOC(=O)c1noc(-c2cc(C)oc2C)n1
InChIInChI=1S/C11H12N2O4/c1-4-15-11(14)9-12-10(17-13-9)8-5-6(2)16-7(8)3/h5H,4H2,1-3H3
InChIKeyNEXXIEZHYSQNLB-UHFFFAOYSA-N
MW236.23 g/mol
LogP2.12
Rot. Bonds3

About ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate

ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate (PubChem CID 63379548) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate.

Molecular Properties

Compound Nameethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate
PubChem CID63379548
Molecular FormulaC11H12N2O4
Molecular Weight236.23 g/mol
Exact Mass236.08
IUPAC Nameethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate
SMILESCCOC(=O)c1noc(-c2cc(C)oc2C)n1
InChIInChI=1S/C11H12N2O4/c1-4-15-11(14)9-12-10(17-13-9)8-5-6(2)16-7(8)3/h5H,4H2,1-3H3
InChIKeyNEXXIEZHYSQNLB-UHFFFAOYSA-N
XLogP2.12
TPSA78.36 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.23
LogP ≤ 52.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate?
The IUPAC name of ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate (CID 63379548) is ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate.
What is the SMILES notation for ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate?
The canonical SMILES for ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate is CCOC(=O)c1noc(-c2cc(C)oc2C)n1.
What is the InChIKey of ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate?
The InChIKey is NEXXIEZHYSQNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O4/c1-4-15-11(14)9-12-10(17-13-9)8-5-6(2)16-7(8)3/h5H,4H2,1-3H3.
What are the key properties of ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate?
ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate has a molecular weight of 236.23 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(2,5-dimethylfuran-3-yl)-1,2,4-oxadiazole-3-carboxylate is sourced from PubChem (CID 63379548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).