About 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one
3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 63379599) has the molecular formula C15H10F2N2OS
and a molecular weight of 304.32 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one.
Molecular Properties
| Compound Name | 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one |
| PubChem CID | 63379599 |
| Molecular Formula | C15H10F2N2OS |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C15H10F2N2OS/c16-10-5-6-12(17)9(7-10)8-19-14(20)11-3-1-2-4-13(11)18-15(19)21/h1-7H,8H2,(H,18,21) |
| InChIKey | UGUVAZCPFMETSB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one?
The IUPAC name of 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one (CID 63379599) is 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one.
What is the SMILES notation for 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one?
The canonical SMILES for 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one is O=c1c2ccccc2[nH]c(=S)n1Cc1cc(F)ccc1F.
What is the InChIKey of 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one?
The InChIKey is UGUVAZCPFMETSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F2N2OS/c16-10-5-6-12(17)9(7-10)8-19-14(20)11-3-1-2-4-13(11)18-15(19)21/h1-7H,8H2,(H,18,21).
What are the key properties of 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one?
3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one has a molecular weight of 304.32 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1H-quinazolin-4-one is sourced from PubChem (CID 63379599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).