C14H22N2O3 — CID 63380820
ethyl 2-[2-[3-(aminomethyl)phenoxy]ethyl-methylamino]acetate (PubChem CID 63380820) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is ethyl 2-[2-[3-(aminomethyl)phenoxy]ethyl-methylamino]acetate.
| Compound Name | ethyl 2-[2-[3-(aminomethyl)phenoxy]ethyl-methylamino]acetate |
|---|---|
| PubChem CID | 63380820 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | ethyl 2-[2-[3-(aminomethyl)phenoxy]ethyl-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)CCOc1cccc(CN)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-3-18-14(17)11-16(2)7-8-19-13-6-4-5-12(9-13)10-15/h4-6,9H,3,7-8,10-11,15H2,1-2H3 |
| InChIKey | CWIZKTHWFMJTPW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |