3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid

C11H6F2N2O2S — CID 63380831

IUPAC3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid
SMILESO=C(O)c1cc(F)c(Sc2cnccn2)c(F)c1
InChIInChI=1S/C11H6F2N2O2S/c12-7-3-6(11(16)17)4-8(13)10(7)18-9-5-14-1-2-15-9/h1-5H,(H,16,17)
InChIKeyQCEUQYRWGIZBIL-UHFFFAOYSA-N
MW268.24 g/mol
LogP2.60
Rot. Bonds3

About 3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid

3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid (PubChem CID 63380831) has the molecular formula C11H6F2N2O2S and a molecular weight of 268.24 g/mol. Its IUPAC name is 3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid.

Molecular Properties

Compound Name3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid
PubChem CID63380831
Molecular FormulaC11H6F2N2O2S
Molecular Weight268.24 g/mol
Exact Mass268.01
IUPAC Name3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid
SMILESO=C(O)c1cc(F)c(Sc2cnccn2)c(F)c1
InChIInChI=1S/C11H6F2N2O2S/c12-7-3-6(11(16)17)4-8(13)10(7)18-9-5-14-1-2-15-9/h1-5H,(H,16,17)
InChIKeyQCEUQYRWGIZBIL-UHFFFAOYSA-N
XLogP2.60
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.24
LogP ≤ 52.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid?
The IUPAC name of 3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid (CID 63380831) is 3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid.
What is the SMILES notation for 3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid?
The canonical SMILES for 3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid is O=C(O)c1cc(F)c(Sc2cnccn2)c(F)c1.
What is the InChIKey of 3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid?
The InChIKey is QCEUQYRWGIZBIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F2N2O2S/c12-7-3-6(11(16)17)4-8(13)10(7)18-9-5-14-1-2-15-9/h1-5H,(H,16,17).
What are the key properties of 3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid?
3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid has a molecular weight of 268.24 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-4-pyrazin-2-ylsulfanylbenzoic acid is sourced from PubChem (CID 63380831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).