About ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate
ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate (PubChem CID 63381324) has the molecular formula C12H11F2N3O3
and a molecular weight of 283.23 g/mol. Its IUPAC name is ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate |
| PubChem CID | 63381324 |
| Molecular Formula | C12H11F2N3O3 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cccc(OC(F)F)c2)n[nH]1 |
| InChI | InChI=1S/C12H11F2N3O3/c1-2-19-11(18)10-15-9(16-17-10)7-4-3-5-8(6-7)20-12(13)14/h3-6,12H,2H2,1H3,(H,15,16,17) |
| InChIKey | XFFSMUWAWIMSQM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate?
The IUPAC name of ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate (CID 63381324) is ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate.
What is the SMILES notation for ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate?
The canonical SMILES for ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate is CCOC(=O)c1nc(-c2cccc(OC(F)F)c2)n[nH]1.
What is the InChIKey of ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate?
The InChIKey is XFFSMUWAWIMSQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F2N3O3/c1-2-19-11(18)10-15-9(16-17-10)7-4-3-5-8(6-7)20-12(13)14/h3-6,12H,2H2,1H3,(H,15,16,17).
What are the key properties of ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate?
ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate has a molecular weight of 283.23 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[3-(difluoromethoxy)phenyl]-1H-1,2,4-triazole-5-carboxylate is sourced from PubChem (CID 63381324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).