C12H10N2O3S — CID 63381744
1-(3,4-dihydroxyphenyl)-2-pyrazin-2-ylsulfanylethanone (PubChem CID 63381744) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-pyrazin-2-ylsulfanylethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-pyrazin-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 63381744 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-pyrazin-2-ylsulfanylethanone |
| SMILES | O=C(CSc1cnccn1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H10N2O3S/c15-9-2-1-8(5-10(9)16)11(17)7-18-12-6-13-3-4-14-12/h1-6,15-16H,7H2 |
| InChIKey | SGYAARCHVMEUBJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|