About ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate
ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate (PubChem CID 63381914) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate |
| PubChem CID | 63381914 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c(CCC(C)C)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-4-15-10(14)9-11-8(12-13-9)6-5-7(2)3/h7H,4-6H2,1-3H3,(H,11,12,13) |
| InChIKey | UHXRIRUFMVLQPC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate?
The IUPAC name of ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate (CID 63381914) is ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate?
The canonical SMILES for ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate is CCOC(=O)c1n[nH]c(CCC(C)C)n1.
What is the InChIKey of ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate?
The InChIKey is UHXRIRUFMVLQPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-4-15-10(14)9-11-8(12-13-9)6-5-7(2)3/h7H,4-6H2,1-3H3,(H,11,12,13).
What are the key properties of ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate?
ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate has a molecular weight of 211.26 g/mol, XLogP of 1.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(3-methylbutyl)-1H-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 63381914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).