C11H19N3O2 — CID 63382084
ethyl 1-methyl-5-pentyl-1,2,4-triazole-3-carboxylate (PubChem CID 63382084) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is ethyl 1-methyl-5-pentyl-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 1-methyl-5-pentyl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 63382084 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | ethyl 1-methyl-5-pentyl-1,2,4-triazole-3-carboxylate |
| SMILES | CCCCCc1nc(C(=O)OCC)nn1C |
| InChI | InChI=1S/C11H19N3O2/c1-4-6-7-8-9-12-10(13-14(9)3)11(15)16-5-2/h4-8H2,1-3H3 |
| InChIKey | CEIQYWZVMNQIQD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|