About 3-tert-butyl-2-chloro-5,8-difluoroquinoline
3-tert-butyl-2-chloro-5,8-difluoroquinoline (PubChem CID 63382310) has the molecular formula C13H12ClF2N
and a molecular weight of 255.69 g/mol. Its IUPAC name is 3-tert-butyl-2-chloro-5,8-difluoroquinoline.
Molecular Properties
| Compound Name | 3-tert-butyl-2-chloro-5,8-difluoroquinoline |
| PubChem CID | 63382310 |
| Molecular Formula | C13H12ClF2N |
| Molecular Weight | 255.69 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 3-tert-butyl-2-chloro-5,8-difluoroquinoline |
| SMILES | CC(C)(C)c1cc2c(F)ccc(F)c2nc1Cl |
| InChI | InChI=1S/C13H12ClF2N/c1-13(2,3)8-6-7-9(15)4-5-10(16)11(7)17-12(8)14/h4-6H,1-3H3 |
| InChIKey | AANYQCNYCMQTGT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-2-chloro-5,8-difluoroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2-chloro-5,8-difluoroquinoline?
The IUPAC name of 3-tert-butyl-2-chloro-5,8-difluoroquinoline (CID 63382310) is 3-tert-butyl-2-chloro-5,8-difluoroquinoline.
What is the SMILES notation for 3-tert-butyl-2-chloro-5,8-difluoroquinoline?
The canonical SMILES for 3-tert-butyl-2-chloro-5,8-difluoroquinoline is CC(C)(C)c1cc2c(F)ccc(F)c2nc1Cl.
What is the InChIKey of 3-tert-butyl-2-chloro-5,8-difluoroquinoline?
The InChIKey is AANYQCNYCMQTGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClF2N/c1-13(2,3)8-6-7-9(15)4-5-10(16)11(7)17-12(8)14/h4-6H,1-3H3.
What are the key properties of 3-tert-butyl-2-chloro-5,8-difluoroquinoline?
3-tert-butyl-2-chloro-5,8-difluoroquinoline has a molecular weight of 255.69 g/mol, XLogP of 4.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2-chloro-5,8-difluoroquinoline is sourced from PubChem (CID 63382310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).