C19H26N2O — CID 6338278
(E)-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-6,7,8,9-tetrahydrobenzo[7]annulen-5-imine (PubChem CID 6338278) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is (E)-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-6,7,8,9-tetrahydrobenzo[7]annulen-5-imine.
| Compound Name | (E)-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-6,7,8,9-tetrahydrobenzo[7]annulen-5-imine |
|---|---|
| PubChem CID | 6338278 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (E)-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-6,7,8,9-tetrahydrobenzo[7]annulen-5-imine |
| SMILES | CN1C2CCC1CC(O/N=C1\CCCCc3ccccc31)C2 |
| InChI | InChI=1S/C19H26N2O/c1-21-15-10-11-16(21)13-17(12-15)22-20-19-9-5-3-7-14-6-2-4-8-18(14)19/h2,4,6,8,15-17H,3,5,7,9-13H2,1H3/b20-19+ |
| InChIKey | BMDOCODTUYXWAL-FMQUCBEESA-N |
| XLogP | 3.76 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|