methyl 2-[2-aminoethyl(propyl)amino]acetate

C8H18N2O2 — CID 63383086

IUPACmethyl 2-[2-aminoethyl(propyl)amino]acetate
SMILESCCCN(CCN)CC(=O)OC
InChIInChI=1S/C8H18N2O2/c1-3-5-10(6-4-9)7-8(11)12-2/h3-7,9H2,1-2H3
InChIKeyQUVHESBDQKHHJT-UHFFFAOYSA-N
MW174.24 g/mol
LogP-0.17
Rot. Bonds6

About methyl 2-[2-aminoethyl(propyl)amino]acetate

methyl 2-[2-aminoethyl(propyl)amino]acetate (PubChem CID 63383086) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is methyl 2-[2-aminoethyl(propyl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[2-aminoethyl(propyl)amino]acetate
PubChem CID63383086
Molecular FormulaC8H18N2O2
Molecular Weight174.24 g/mol
Exact Mass174.14
IUPAC Namemethyl 2-[2-aminoethyl(propyl)amino]acetate
SMILESCCCN(CCN)CC(=O)OC
InChIInChI=1S/C8H18N2O2/c1-3-5-10(6-4-9)7-8(11)12-2/h3-7,9H2,1-2H3
InChIKeyQUVHESBDQKHHJT-UHFFFAOYSA-N
XLogP-0.17
TPSA55.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.24
LogP ≤ 5-0.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-[2-aminoethyl(propyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-aminoethyl(propyl)amino]acetate?
The IUPAC name of methyl 2-[2-aminoethyl(propyl)amino]acetate (CID 63383086) is methyl 2-[2-aminoethyl(propyl)amino]acetate.
What is the SMILES notation for methyl 2-[2-aminoethyl(propyl)amino]acetate?
The canonical SMILES for methyl 2-[2-aminoethyl(propyl)amino]acetate is CCCN(CCN)CC(=O)OC.
What is the InChIKey of methyl 2-[2-aminoethyl(propyl)amino]acetate?
The InChIKey is QUVHESBDQKHHJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-3-5-10(6-4-9)7-8(11)12-2/h3-7,9H2,1-2H3.
What are the key properties of methyl 2-[2-aminoethyl(propyl)amino]acetate?
methyl 2-[2-aminoethyl(propyl)amino]acetate has a molecular weight of 174.24 g/mol, XLogP of -0.17, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-aminoethyl(propyl)amino]acetate is sourced from PubChem (CID 63383086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).