About 2-cycloheptyl-5-iodo-1,3,4-thiadiazole
2-cycloheptyl-5-iodo-1,3,4-thiadiazole (PubChem CID 63383517) has the molecular formula C9H13IN2S
and a molecular weight of 308.19 g/mol. Its IUPAC name is 2-cycloheptyl-5-iodo-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-cycloheptyl-5-iodo-1,3,4-thiadiazole |
| PubChem CID | 63383517 |
| Molecular Formula | C9H13IN2S |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 2-cycloheptyl-5-iodo-1,3,4-thiadiazole |
| SMILES | Ic1nnc(C2CCCCCC2)s1 |
| InChI | InChI=1S/C9H13IN2S/c10-9-12-11-8(13-9)7-5-3-1-2-4-6-7/h7H,1-6H2 |
| InChIKey | JSXZOZQIGKCWAO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-cycloheptyl-5-iodo-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyl-5-iodo-1,3,4-thiadiazole?
The IUPAC name of 2-cycloheptyl-5-iodo-1,3,4-thiadiazole (CID 63383517) is 2-cycloheptyl-5-iodo-1,3,4-thiadiazole.
What is the SMILES notation for 2-cycloheptyl-5-iodo-1,3,4-thiadiazole?
The canonical SMILES for 2-cycloheptyl-5-iodo-1,3,4-thiadiazole is Ic1nnc(C2CCCCCC2)s1.
What is the InChIKey of 2-cycloheptyl-5-iodo-1,3,4-thiadiazole?
The InChIKey is JSXZOZQIGKCWAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13IN2S/c10-9-12-11-8(13-9)7-5-3-1-2-4-6-7/h7H,1-6H2.
What are the key properties of 2-cycloheptyl-5-iodo-1,3,4-thiadiazole?
2-cycloheptyl-5-iodo-1,3,4-thiadiazole has a molecular weight of 308.19 g/mol, XLogP of 3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyl-5-iodo-1,3,4-thiadiazole is sourced from PubChem (CID 63383517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).