C11H11IN2OS — CID 63383570
2-iodo-5-[2-(3-methylphenoxy)ethyl]-1,3,4-thiadiazole (PubChem CID 63383570) has the molecular formula C11H11IN2OS and a molecular weight of 346.19 g/mol. Its IUPAC name is 2-iodo-5-[2-(3-methylphenoxy)ethyl]-1,3,4-thiadiazole.
| Compound Name | 2-iodo-5-[2-(3-methylphenoxy)ethyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63383570 |
| Molecular Formula | C11H11IN2OS |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 2-iodo-5-[2-(3-methylphenoxy)ethyl]-1,3,4-thiadiazole |
| SMILES | Cc1cccc(OCCc2nnc(I)s2)c1 |
| InChI | InChI=1S/C11H11IN2OS/c1-8-3-2-4-9(7-8)15-6-5-10-13-14-11(12)16-10/h2-4,7H,5-6H2,1H3 |
| InChIKey | IZVFKHSRSFHCDJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|