C8H2ClF3N2S — CID 63383602
2-chloro-5-(3,4,5-trifluorophenyl)-1,3,4-thiadiazole (PubChem CID 63383602) has the molecular formula C8H2ClF3N2S and a molecular weight of 250.63 g/mol. Its IUPAC name is 2-chloro-5-(3,4,5-trifluorophenyl)-1,3,4-thiadiazole.
| Compound Name | 2-chloro-5-(3,4,5-trifluorophenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63383602 |
| Molecular Formula | C8H2ClF3N2S |
| Molecular Weight | 250.63 g/mol |
| Exact Mass | 249.96 |
| IUPAC Name | 2-chloro-5-(3,4,5-trifluorophenyl)-1,3,4-thiadiazole |
| SMILES | Fc1cc(-c2nnc(Cl)s2)cc(F)c1F |
| InChI | InChI=1S/C8H2ClF3N2S/c9-8-14-13-7(15-8)3-1-4(10)6(12)5(11)2-3/h1-2H |
| InChIKey | QKYDTJGDVLMTGU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.63 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|