C17H14ClN3 — CID 63383941
3-chloro-4-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,2,4-triazole (PubChem CID 63383941) has the molecular formula C17H14ClN3 and a molecular weight of 295.77 g/mol. Its IUPAC name is 3-chloro-4-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,2,4-triazole.
| Compound Name | 3-chloro-4-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 63383941 |
| Molecular Formula | C17H14ClN3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-chloro-4-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,2,4-triazole |
| SMILES | Clc1nnc(-c2ccccc2)n1-c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H14ClN3/c18-17-20-19-16(13-5-2-1-3-6-13)21(17)15-10-9-12-7-4-8-14(12)11-15/h1-3,5-6,9-11H,4,7-8H2 |
| InChIKey | KENPUZFMOZHMHY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |