C15H22ClN3 — CID 63383989
4-(1-adamantyl)-3-chloro-5-propan-2-yl-1,2,4-triazole (PubChem CID 63383989) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is 4-(1-adamantyl)-3-chloro-5-propan-2-yl-1,2,4-triazole.
| Compound Name | 4-(1-adamantyl)-3-chloro-5-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 63383989 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 4-(1-adamantyl)-3-chloro-5-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)c1nnc(Cl)n1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H22ClN3/c1-9(2)13-17-18-14(16)19(13)15-6-10-3-11(7-15)5-12(4-10)8-15/h9-12H,3-8H2,1-2H3 |
| InChIKey | KQCCYFUEWMWXTK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |