C10H17BrN2S — CID 63384129
2-bromo-5-(2,4,4-trimethylpentyl)-1,3,4-thiadiazole (PubChem CID 63384129) has the molecular formula C10H17BrN2S and a molecular weight of 277.23 g/mol. Its IUPAC name is 2-bromo-5-(2,4,4-trimethylpentyl)-1,3,4-thiadiazole.
| Compound Name | 2-bromo-5-(2,4,4-trimethylpentyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63384129 |
| Molecular Formula | C10H17BrN2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-bromo-5-(2,4,4-trimethylpentyl)-1,3,4-thiadiazole |
| SMILES | CC(Cc1nnc(Br)s1)CC(C)(C)C |
| InChI | InChI=1S/C10H17BrN2S/c1-7(6-10(2,3)4)5-8-12-13-9(11)14-8/h7H,5-6H2,1-4H3 |
| InChIKey | CYNMPDPMBPAUCD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |