C14H18ClN3 — CID 63384558
3-chloro-4-(4-methylpentan-2-yl)-5-phenyl-1,2,4-triazole (PubChem CID 63384558) has the molecular formula C14H18ClN3 and a molecular weight of 263.77 g/mol. Its IUPAC name is 3-chloro-4-(4-methylpentan-2-yl)-5-phenyl-1,2,4-triazole.
| Compound Name | 3-chloro-4-(4-methylpentan-2-yl)-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 63384558 |
| Molecular Formula | C14H18ClN3 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-chloro-4-(4-methylpentan-2-yl)-5-phenyl-1,2,4-triazole |
| SMILES | CC(C)CC(C)n1c(Cl)nnc1-c1ccccc1 |
| InChI | InChI=1S/C14H18ClN3/c1-10(2)9-11(3)18-13(16-17-14(18)15)12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | CSVLVTPOUDHVJZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |