About 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine
2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine (PubChem CID 63385296) has the molecular formula C9H10ClN5
and a molecular weight of 223.67 g/mol. Its IUPAC name is 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine.
Molecular Properties
| Compound Name | 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine |
| PubChem CID | 63385296 |
| Molecular Formula | C9H10ClN5 |
| Molecular Weight | 223.67 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine |
| SMILES | Cc1cnc(Cn2c(C)nnc2Cl)cn1 |
| InChI | InChI=1S/C9H10ClN5/c1-6-3-12-8(4-11-6)5-15-7(2)13-14-9(15)10/h3-4H,5H2,1-2H3 |
| InChIKey | KZNIWTFNAPYOTR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.67 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine?
The IUPAC name of 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine (CID 63385296) is 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine.
What is the SMILES notation for 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine?
The canonical SMILES for 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine is Cc1cnc(Cn2c(C)nnc2Cl)cn1.
What is the InChIKey of 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine?
The InChIKey is KZNIWTFNAPYOTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN5/c1-6-3-12-8(4-11-6)5-15-7(2)13-14-9(15)10/h3-4H,5H2,1-2H3.
What are the key properties of 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine?
2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine has a molecular weight of 223.67 g/mol, XLogP of 1.39, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-chloro-5-methyl-1,2,4-triazol-4-yl)methyl]-5-methylpyrazine is sourced from PubChem (CID 63385296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).