C12H15F2N — CID 63386189
5,7-difluoro-3-propyl-1,2,3,4-tetrahydroquinoline (PubChem CID 63386189) has the molecular formula C12H15F2N and a molecular weight of 211.25 g/mol. Its IUPAC name is 5,7-difluoro-3-propyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5,7-difluoro-3-propyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 63386189 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 5,7-difluoro-3-propyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCC1CNc2cc(F)cc(F)c2C1 |
| InChI | InChI=1S/C12H15F2N/c1-2-3-8-4-10-11(14)5-9(13)6-12(10)15-7-8/h5-6,8,15H,2-4,7H2,1H3 |
| InChIKey | KPVBBWXYNFHBSY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |