C12H14F3N — CID 63386241
5,7,8-trifluoro-3-propan-2-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 63386241) has the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. Its IUPAC name is 5,7,8-trifluoro-3-propan-2-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5,7,8-trifluoro-3-propan-2-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 63386241 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 5,7,8-trifluoro-3-propan-2-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC(C)C1CNc2c(F)c(F)cc(F)c2C1 |
| InChI | InChI=1S/C12H14F3N/c1-6(2)7-3-8-9(13)4-10(14)11(15)12(8)16-5-7/h4,6-7,16H,3,5H2,1-2H3 |
| InChIKey | NJWLDQTYYUFXKJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|