C10H12BrClFN — CID 63386609
N-[(4-bromo-2-fluorophenyl)methyl]-2-chloro-N-methylethanamine (PubChem CID 63386609) has the molecular formula C10H12BrClFN and a molecular weight of 280.57 g/mol. Its IUPAC name is N-[(4-bromo-2-fluorophenyl)methyl]-2-chloro-N-methylethanamine.
| Compound Name | N-[(4-bromo-2-fluorophenyl)methyl]-2-chloro-N-methylethanamine |
|---|---|
| PubChem CID | 63386609 |
| Molecular Formula | C10H12BrClFN |
| Molecular Weight | 280.57 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | N-[(4-bromo-2-fluorophenyl)methyl]-2-chloro-N-methylethanamine |
| SMILES | CN(CCCl)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C10H12BrClFN/c1-14(5-4-12)7-8-2-3-9(11)6-10(8)13/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | HVHYNFQYLQGHRS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|