C10H19ClF3NO2 — CID 63387453
2-chloro-3-methoxy-N-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]propan-1-amine (PubChem CID 63387453) has the molecular formula C10H19ClF3NO2 and a molecular weight of 277.71 g/mol. Its IUPAC name is 2-chloro-3-methoxy-N-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]propan-1-amine.
| Compound Name | 2-chloro-3-methoxy-N-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]propan-1-amine |
|---|---|
| PubChem CID | 63387453 |
| Molecular Formula | C10H19ClF3NO2 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-chloro-3-methoxy-N-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]propan-1-amine |
| SMILES | COCC(Cl)CN(C)CCCOCC(F)(F)F |
| InChI | InChI=1S/C10H19ClF3NO2/c1-15(6-9(11)7-16-2)4-3-5-17-8-10(12,13)14/h9H,3-8H2,1-2H3 |
| InChIKey | MCWNPCKYABFVDA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|