C9H21ClN2O — CID 63387619
N'-(2-chloro-3-methoxypropyl)-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 63387619) has the molecular formula C9H21ClN2O and a molecular weight of 208.73 g/mol. Its IUPAC name is N'-(2-chloro-3-methoxypropyl)-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-(2-chloro-3-methoxypropyl)-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 63387619 |
| Molecular Formula | C9H21ClN2O |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | N'-(2-chloro-3-methoxypropyl)-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | COCC(Cl)CN(C)CCN(C)C |
| InChI | InChI=1S/C9H21ClN2O/c1-11(2)5-6-12(3)7-9(10)8-13-4/h9H,5-8H2,1-4H3 |
| InChIKey | SBNIRMKFNRBZGH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|