C13H17ClF3NO — CID 63388001
2-chloro-3-methoxy-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]propan-1-amine (PubChem CID 63388001) has the molecular formula C13H17ClF3NO and a molecular weight of 295.73 g/mol. Its IUPAC name is 2-chloro-3-methoxy-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]propan-1-amine.
| Compound Name | 2-chloro-3-methoxy-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63388001 |
| Molecular Formula | C13H17ClF3NO |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-chloro-3-methoxy-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]propan-1-amine |
| SMILES | COCC(Cl)CN(C)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17ClF3NO/c1-18(8-12(14)9-19-2)7-10-4-3-5-11(6-10)13(15,16)17/h3-6,12H,7-9H2,1-2H3 |
| InChIKey | DHIWNBKCAAVFPW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|