C13H23ClN4 — CID 63388085
1-(2-chloroethyl)-4-[(1-ethylpyrazol-4-yl)methyl]-1,4-diazepane (PubChem CID 63388085) has the molecular formula C13H23ClN4 and a molecular weight of 270.81 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-[(1-ethylpyrazol-4-yl)methyl]-1,4-diazepane.
| Compound Name | 1-(2-chloroethyl)-4-[(1-ethylpyrazol-4-yl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 63388085 |
| Molecular Formula | C13H23ClN4 |
| Molecular Weight | 270.81 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-(2-chloroethyl)-4-[(1-ethylpyrazol-4-yl)methyl]-1,4-diazepane |
| SMILES | CCn1cc(CN2CCCN(CCCl)CC2)cn1 |
| InChI | InChI=1S/C13H23ClN4/c1-2-18-12-13(10-15-18)11-17-6-3-5-16(7-4-14)8-9-17/h10,12H,2-9,11H2,1H3 |
| InChIKey | ZADQLRAGOYHMEB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.81 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|