C10H14ClN3 — CID 63390343
2-[3-(chloromethyl)pyrrolidin-1-yl]-4-methylpyrimidine (PubChem CID 63390343) has the molecular formula C10H14ClN3 and a molecular weight of 211.70 g/mol. Its IUPAC name is 2-[3-(chloromethyl)pyrrolidin-1-yl]-4-methylpyrimidine.
| Compound Name | 2-[3-(chloromethyl)pyrrolidin-1-yl]-4-methylpyrimidine |
|---|---|
| PubChem CID | 63390343 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 2-[3-(chloromethyl)pyrrolidin-1-yl]-4-methylpyrimidine |
| SMILES | Cc1ccnc(N2CCC(CCl)C2)n1 |
| InChI | InChI=1S/C10H14ClN3/c1-8-2-4-12-10(13-8)14-5-3-9(6-11)7-14/h2,4,9H,3,5-7H2,1H3 |
| InChIKey | WRANPGZPKXQMTM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|