About N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine
N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 63390410) has the molecular formula C12H13ClN2O2S
and a molecular weight of 284.77 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine.
Molecular Properties
| Compound Name | N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine |
| PubChem CID | 63390410 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | O=S1(=O)N=C(N(CCCl)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C12H13ClN2O2S/c13-7-8-15(9-5-6-9)12-10-3-1-2-4-11(10)18(16,17)14-12/h1-4,9H,5-8H2 |
| InChIKey | CAPQKFCUVRBYAO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine?
The IUPAC name of N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine (CID 63390410) is N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine.
What is the SMILES notation for N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine?
The canonical SMILES for N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine is O=S1(=O)N=C(N(CCCl)C2CC2)c2ccccc21.
What is the InChIKey of N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine?
The InChIKey is CAPQKFCUVRBYAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O2S/c13-7-8-15(9-5-6-9)12-10-3-1-2-4-11(10)18(16,17)14-12/h1-4,9H,5-8H2.
What are the key properties of N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine?
N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine has a molecular weight of 284.77 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)-N-cyclopropyl-1,1-dioxo-1,2-benzothiazol-3-amine is sourced from PubChem (CID 63390410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).