C12H24ClNO — CID 63390552
N-(3-chloropropyl)-2,2-dimethyl-N-propan-2-ylbutanamide (PubChem CID 63390552) has the molecular formula C12H24ClNO and a molecular weight of 233.78 g/mol. Its IUPAC name is N-(3-chloropropyl)-2,2-dimethyl-N-propan-2-ylbutanamide.
| Compound Name | N-(3-chloropropyl)-2,2-dimethyl-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 63390552 |
| Molecular Formula | C12H24ClNO |
| Molecular Weight | 233.78 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | N-(3-chloropropyl)-2,2-dimethyl-N-propan-2-ylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(CCCCl)C(C)C |
| InChI | InChI=1S/C12H24ClNO/c1-6-12(4,5)11(15)14(10(2)3)9-7-8-13/h10H,6-9H2,1-5H3 |
| InChIKey | RMNWQRTZXGIBGE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.78 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|