C15H18ClF2NO — CID 63391286
N-(2-chloroethyl)-N-cyclohexyl-2,5-difluorobenzamide (PubChem CID 63391286) has the molecular formula C15H18ClF2NO and a molecular weight of 301.76 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-cyclohexyl-2,5-difluorobenzamide.
| Compound Name | N-(2-chloroethyl)-N-cyclohexyl-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 63391286 |
| Molecular Formula | C15H18ClF2NO |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-(2-chloroethyl)-N-cyclohexyl-2,5-difluorobenzamide |
| SMILES | O=C(c1cc(F)ccc1F)N(CCCl)C1CCCCC1 |
| InChI | InChI=1S/C15H18ClF2NO/c16-8-9-19(12-4-2-1-3-5-12)15(20)13-10-11(17)6-7-14(13)18/h6-7,10,12H,1-5,8-9H2 |
| InChIKey | LNZAANPRIXQIHI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|