About N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide
N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide (PubChem CID 63391388) has the molecular formula C8H12ClN3O
and a molecular weight of 201.66 g/mol. Its IUPAC name is N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide |
| PubChem CID | 63391388 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide |
| SMILES | CN(CCCl)C(=O)c1ccnn1C |
| InChI | InChI=1S/C8H12ClN3O/c1-11(6-4-9)8(13)7-3-5-10-12(7)2/h3,5H,4,6H2,1-2H3 |
| InChIKey | MQHQELQOJRLGEH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide?
The IUPAC name of N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide (CID 63391388) is N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide.
What is the SMILES notation for N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide?
The canonical SMILES for N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide is CN(CCCl)C(=O)c1ccnn1C.
What is the InChIKey of N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide?
The InChIKey is MQHQELQOJRLGEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClN3O/c1-11(6-4-9)8(13)7-3-5-10-12(7)2/h3,5H,4,6H2,1-2H3.
What are the key properties of N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide?
N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide has a molecular weight of 201.66 g/mol, XLogP of 0.73, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)-N,2-dimethylpyrazole-3-carboxamide is sourced from PubChem (CID 63391388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).