C16H22ClNO — CID 63391726
N-(2-chloroethyl)-N-cyclopentyl-2,3-dimethylbenzamide (PubChem CID 63391726) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-cyclopentyl-2,3-dimethylbenzamide.
| Compound Name | N-(2-chloroethyl)-N-cyclopentyl-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 63391726 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N-(2-chloroethyl)-N-cyclopentyl-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(CCCl)C2CCCC2)c1C |
| InChI | InChI=1S/C16H22ClNO/c1-12-6-5-9-15(13(12)2)16(19)18(11-10-17)14-7-3-4-8-14/h5-6,9,14H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | RBXHDXWBHVGOQY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|