C11H16ClN3 — CID 63391936
2-(3-chloropiperidin-1-yl)-4,6-dimethylpyrimidine (PubChem CID 63391936) has the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. Its IUPAC name is 2-(3-chloropiperidin-1-yl)-4,6-dimethylpyrimidine.
| Compound Name | 2-(3-chloropiperidin-1-yl)-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 63391936 |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(3-chloropiperidin-1-yl)-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(N2CCCC(Cl)C2)n1 |
| InChI | InChI=1S/C11H16ClN3/c1-8-6-9(2)14-11(13-8)15-5-3-4-10(12)7-15/h6,10H,3-5,7H2,1-2H3 |
| InChIKey | PDEIXFRMPUPGPF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|