C15H20ClN3S — CID 63392557
4-[2-(2-chloroethyl)piperidin-1-yl]-6-ethylthieno[2,3-d]pyrimidine (PubChem CID 63392557) has the molecular formula C15H20ClN3S and a molecular weight of 309.87 g/mol. Its IUPAC name is 4-[2-(2-chloroethyl)piperidin-1-yl]-6-ethylthieno[2,3-d]pyrimidine.
| Compound Name | 4-[2-(2-chloroethyl)piperidin-1-yl]-6-ethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 63392557 |
| Molecular Formula | C15H20ClN3S |
| Molecular Weight | 309.87 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-[2-(2-chloroethyl)piperidin-1-yl]-6-ethylthieno[2,3-d]pyrimidine |
| SMILES | CCc1cc2c(N3CCCCC3CCCl)ncnc2s1 |
| InChI | InChI=1S/C15H20ClN3S/c1-2-12-9-13-14(17-10-18-15(13)20-12)19-8-4-3-5-11(19)6-7-16/h9-11H,2-8H2,1H3 |
| InChIKey | AAECAWHKSKRYPV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.87 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|