C13H16ClNO3S — CID 63394709
N-(2-chloroethyl)-N-cyclopropyl-4-methylsulfonylbenzamide (PubChem CID 63394709) has the molecular formula C13H16ClNO3S and a molecular weight of 301.80 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-cyclopropyl-4-methylsulfonylbenzamide.
| Compound Name | N-(2-chloroethyl)-N-cyclopropyl-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 63394709 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-(2-chloroethyl)-N-cyclopropyl-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N(CCCl)C2CC2)cc1 |
| InChI | InChI=1S/C13H16ClNO3S/c1-19(17,18)12-6-2-10(3-7-12)13(16)15(9-8-14)11-4-5-11/h2-3,6-7,11H,4-5,8-9H2,1H3 |
| InChIKey | IPADYIIXMIXJNP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|