C17H24ClNO — CID 63395665
1-[3-(2-chloroethyl)piperidin-1-yl]-3-(3-methylphenyl)propan-1-one (PubChem CID 63395665) has the molecular formula C17H24ClNO and a molecular weight of 293.84 g/mol. Its IUPAC name is 1-[3-(2-chloroethyl)piperidin-1-yl]-3-(3-methylphenyl)propan-1-one.
| Compound Name | 1-[3-(2-chloroethyl)piperidin-1-yl]-3-(3-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 63395665 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 1-[3-(2-chloroethyl)piperidin-1-yl]-3-(3-methylphenyl)propan-1-one |
| SMILES | Cc1cccc(CCC(=O)N2CCCC(CCCl)C2)c1 |
| InChI | InChI=1S/C17H24ClNO/c1-14-4-2-5-15(12-14)7-8-17(20)19-11-3-6-16(13-19)9-10-18/h2,4-5,12,16H,3,6-11,13H2,1H3 |
| InChIKey | CNQYYXGZJLOOPO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|