C16H21Cl2NO2 — CID 63395750
1-[3-(2-chloroethyl)piperidin-1-yl]-2-(3-chlorophenoxy)propan-1-one (PubChem CID 63395750) has the molecular formula C16H21Cl2NO2 and a molecular weight of 330.25 g/mol. Its IUPAC name is 1-[3-(2-chloroethyl)piperidin-1-yl]-2-(3-chlorophenoxy)propan-1-one.
| Compound Name | 1-[3-(2-chloroethyl)piperidin-1-yl]-2-(3-chlorophenoxy)propan-1-one |
|---|---|
| PubChem CID | 63395750 |
| Molecular Formula | C16H21Cl2NO2 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-[3-(2-chloroethyl)piperidin-1-yl]-2-(3-chlorophenoxy)propan-1-one |
| SMILES | CC(Oc1cccc(Cl)c1)C(=O)N1CCCC(CCCl)C1 |
| InChI | InChI=1S/C16H21Cl2NO2/c1-12(21-15-6-2-5-14(18)10-15)16(20)19-9-3-4-13(11-19)7-8-17/h2,5-6,10,12-13H,3-4,7-9,11H2,1H3 |
| InChIKey | YEWSNGLEZXSQFZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|