About N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide
N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide (PubChem CID 63396417) has the molecular formula C7H14ClF2NO2S
and a molecular weight of 249.71 g/mol. Its IUPAC name is N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide |
| PubChem CID | 63396417 |
| Molecular Formula | C7H14ClF2NO2S |
| Molecular Weight | 249.71 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide |
| SMILES | CC(C)N(CCCCl)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H14ClF2NO2S/c1-6(2)11(5-3-4-8)14(12,13)7(9)10/h6-7H,3-5H2,1-2H3 |
| InChIKey | GUTJXDJHDXITSC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.71 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide?
The IUPAC name of N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide (CID 63396417) is N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide.
What is the SMILES notation for N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide?
The canonical SMILES for N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide is CC(C)N(CCCCl)S(=O)(=O)C(F)F.
What is the InChIKey of N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide?
The InChIKey is GUTJXDJHDXITSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClF2NO2S/c1-6(2)11(5-3-4-8)14(12,13)7(9)10/h6-7H,3-5H2,1-2H3.
What are the key properties of N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide?
N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide has a molecular weight of 249.71 g/mol, XLogP of 1.88, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloropropyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide is sourced from PubChem (CID 63396417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).