About N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide
N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide (PubChem CID 63396737) has the molecular formula C9H19ClN2O2S
and a molecular weight of 254.78 g/mol. Its IUPAC name is N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide |
| PubChem CID | 63396737 |
| Molecular Formula | C9H19ClN2O2S |
| Molecular Weight | 254.78 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide |
| SMILES | CC1CCCCN1S(=O)(=O)N(C)CCCl |
| InChI | InChI=1S/C9H19ClN2O2S/c1-9-5-3-4-7-12(9)15(13,14)11(2)8-6-10/h9H,3-8H2,1-2H3 |
| InChIKey | GEOLDHLZAKDXQF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.78 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide?
The IUPAC name of N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide (CID 63396737) is N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide.
What is the SMILES notation for N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide?
The canonical SMILES for N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide is CC1CCCCN1S(=O)(=O)N(C)CCCl.
What is the InChIKey of N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide?
The InChIKey is GEOLDHLZAKDXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19ClN2O2S/c1-9-5-3-4-7-12(9)15(13,14)11(2)8-6-10/h9H,3-8H2,1-2H3.
What are the key properties of N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide?
N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide has a molecular weight of 254.78 g/mol, XLogP of 1.28, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)-N,2-dimethylpiperidine-1-sulfonamide is sourced from PubChem (CID 63396737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).