About N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide
N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide (PubChem CID 63397908) has the molecular formula C11H22ClNO2
and a molecular weight of 235.75 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide.
Molecular Properties
| Compound Name | N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide |
| PubChem CID | 63397908 |
| Molecular Formula | C11H22ClNO2 |
| Molecular Weight | 235.75 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(C)CC(Cl)COC |
| InChI | InChI=1S/C11H22ClNO2/c1-6-11(2,3)10(14)13(4)7-9(12)8-15-5/h9H,6-8H2,1-5H3 |
| InChIKey | SFTMZNBPXHIGQS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.75 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide?
The IUPAC name of N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide (CID 63397908) is N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide.
What is the SMILES notation for N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide?
The canonical SMILES for N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide is CCC(C)(C)C(=O)N(C)CC(Cl)COC.
What is the InChIKey of N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide?
The InChIKey is SFTMZNBPXHIGQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22ClNO2/c1-6-11(2,3)10(14)13(4)7-9(12)8-15-5/h9H,6-8H2,1-5H3.
What are the key properties of N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide?
N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide has a molecular weight of 235.75 g/mol, XLogP of 2.13, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-3-methoxypropyl)-N,2,2-trimethylbutanamide is sourced from PubChem (CID 63397908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).