About N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide
N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide (PubChem CID 63397957) has the molecular formula C10H20ClNO2
and a molecular weight of 221.73 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide |
| PubChem CID | 63397957 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide |
| SMILES | COCC(Cl)CN(C)C(=O)CC(C)C |
| InChI | InChI=1S/C10H20ClNO2/c1-8(2)5-10(13)12(3)6-9(11)7-14-4/h8-9H,5-7H2,1-4H3 |
| InChIKey | FSAMSCLAHXFDEZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide?
The IUPAC name of N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide (CID 63397957) is N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide.
What is the SMILES notation for N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide?
The canonical SMILES for N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide is COCC(Cl)CN(C)C(=O)CC(C)C.
What is the InChIKey of N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide?
The InChIKey is FSAMSCLAHXFDEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClNO2/c1-8(2)5-10(13)12(3)6-9(11)7-14-4/h8-9H,5-7H2,1-4H3.
What are the key properties of N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide?
N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide has a molecular weight of 221.73 g/mol, XLogP of 1.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-3-methoxypropyl)-N,3-dimethylbutanamide is sourced from PubChem (CID 63397957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).