C17H26ClNOS — CID 63398216
N-(2-chloroethyl)-N-pentan-3-yl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide (PubChem CID 63398216) has the molecular formula C17H26ClNOS and a molecular weight of 327.92 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-pentan-3-yl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-pentan-3-yl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63398216 |
| Molecular Formula | C17H26ClNOS |
| Molecular Weight | 327.92 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-(2-chloroethyl)-N-pentan-3-yl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide |
| SMILES | CCC(CC)N(CCCl)C(=O)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C17H26ClNOS/c1-3-14(4-2)19(11-10-18)17(20)16-12-13-8-6-5-7-9-15(13)21-16/h12,14H,3-11H2,1-2H3 |
| InChIKey | PRKHDYLSLWMMLH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.92 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|