C16H18F3NO — CID 63399021
N-ethyl-1-[5-[4-methyl-3-(trifluoromethyl)phenyl]furan-2-yl]ethanamine (PubChem CID 63399021) has the molecular formula C16H18F3NO and a molecular weight of 297.32 g/mol. Its IUPAC name is N-ethyl-1-[5-[4-methyl-3-(trifluoromethyl)phenyl]furan-2-yl]ethanamine.
| Compound Name | N-ethyl-1-[5-[4-methyl-3-(trifluoromethyl)phenyl]furan-2-yl]ethanamine |
|---|---|
| PubChem CID | 63399021 |
| Molecular Formula | C16H18F3NO |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-ethyl-1-[5-[4-methyl-3-(trifluoromethyl)phenyl]furan-2-yl]ethanamine |
| SMILES | CCNC(C)c1ccc(-c2ccc(C)c(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C16H18F3NO/c1-4-20-11(3)14-7-8-15(21-14)12-6-5-10(2)13(9-12)16(17,18)19/h5-9,11,20H,4H2,1-3H3 |
| InChIKey | XOWDRARCHYNWIW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |