C18H33NO — CID 63399358
6-tert-butyl-4'-methylspiro[2,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-3,1'-cyclohexane] (PubChem CID 63399358) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 6-tert-butyl-4'-methylspiro[2,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-3,1'-cyclohexane].
| Compound Name | 6-tert-butyl-4'-methylspiro[2,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 63399358 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 6-tert-butyl-4'-methylspiro[2,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-3,1'-cyclohexane] |
| SMILES | CC1CCC2(CC1)COC1CCC(C(C)(C)C)CC1N2 |
| InChI | InChI=1S/C18H33NO/c1-13-7-9-18(10-8-13)12-20-16-6-5-14(17(2,3)4)11-15(16)19-18/h13-16,19H,5-12H2,1-4H3 |
| InChIKey | UWSAUCZKVIHYEB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |