C16H17Cl2N — CID 63400103
3-(3,4-dichlorophenyl)-N-methyl-1-phenylpropan-1-amine (PubChem CID 63400103) has the molecular formula C16H17Cl2N and a molecular weight of 294.23 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-methyl-1-phenylpropan-1-amine.
| Compound Name | 3-(3,4-dichlorophenyl)-N-methyl-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 63400103 |
| Molecular Formula | C16H17Cl2N |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-methyl-1-phenylpropan-1-amine |
| SMILES | CNC(CCc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C16H17Cl2N/c1-19-16(13-5-3-2-4-6-13)10-8-12-7-9-14(17)15(18)11-12/h2-7,9,11,16,19H,8,10H2,1H3 |
| InChIKey | GSGMEVOPHYLLIT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |