About 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine
1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine (PubChem CID 63400441) has the molecular formula C15H17Br2NS
and a molecular weight of 403.18 g/mol. Its IUPAC name is 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine |
| PubChem CID | 63400441 |
| Molecular Formula | C15H17Br2NS |
| Molecular Weight | 403.18 g/mol |
| Exact Mass | 400.94 |
| IUPAC Name | 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine |
| SMILES | CNC(c1ccc(-c2cc(Br)ccc2Br)s1)C(C)C |
| InChI | InChI=1S/C15H17Br2NS/c1-9(2)15(18-3)14-7-6-13(19-14)11-8-10(16)4-5-12(11)17/h4-9,15,18H,1-3H3 |
| InChIKey | RXLKLURYDRNNMF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.18 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine?
The IUPAC name of 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine (CID 63400441) is 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine.
What is the SMILES notation for 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine?
The canonical SMILES for 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine is CNC(c1ccc(-c2cc(Br)ccc2Br)s1)C(C)C.
What is the InChIKey of 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine?
The InChIKey is RXLKLURYDRNNMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Br2NS/c1-9(2)15(18-3)14-7-6-13(19-14)11-8-10(16)4-5-12(11)17/h4-9,15,18H,1-3H3.
What are the key properties of 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine?
1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine has a molecular weight of 403.18 g/mol, XLogP of 5.86, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,5-dibromophenyl)thiophen-2-yl]-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 63400441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).