C9H14ClN3O2S — CID 63400848
4-[3-(chloromethyl)pyrrolidin-1-yl]sulfonyl-5-methyl-1H-pyrazole (PubChem CID 63400848) has the molecular formula C9H14ClN3O2S and a molecular weight of 263.75 g/mol. Its IUPAC name is 4-[3-(chloromethyl)pyrrolidin-1-yl]sulfonyl-5-methyl-1H-pyrazole.
| Compound Name | 4-[3-(chloromethyl)pyrrolidin-1-yl]sulfonyl-5-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 63400848 |
| Molecular Formula | C9H14ClN3O2S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 4-[3-(chloromethyl)pyrrolidin-1-yl]sulfonyl-5-methyl-1H-pyrazole |
| SMILES | Cc1[nH]ncc1S(=O)(=O)N1CCC(CCl)C1 |
| InChI | InChI=1S/C9H14ClN3O2S/c1-7-9(5-11-12-7)16(14,15)13-3-2-8(4-10)6-13/h5,8H,2-4,6H2,1H3,(H,11,12) |
| InChIKey | VFMNSNZZXLWURP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|