C16H23BrFN — CID 63401105
2-[(3-bromo-4-fluorophenyl)methyl]-4-propan-2-ylcyclohexan-1-amine (PubChem CID 63401105) has the molecular formula C16H23BrFN and a molecular weight of 328.27 g/mol. Its IUPAC name is 2-[(3-bromo-4-fluorophenyl)methyl]-4-propan-2-ylcyclohexan-1-amine.
| Compound Name | 2-[(3-bromo-4-fluorophenyl)methyl]-4-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 63401105 |
| Molecular Formula | C16H23BrFN |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-[(3-bromo-4-fluorophenyl)methyl]-4-propan-2-ylcyclohexan-1-amine |
| SMILES | CC(C)C1CCC(N)C(Cc2ccc(F)c(Br)c2)C1 |
| InChI | InChI=1S/C16H23BrFN/c1-10(2)12-4-6-16(19)13(9-12)7-11-3-5-15(18)14(17)8-11/h3,5,8,10,12-13,16H,4,6-7,9,19H2,1-2H3 |
| InChIKey | MXCNHLNQNITPDG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |