About 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine
2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine (PubChem CID 63402001) has the molecular formula C8H8ClN5S
and a molecular weight of 241.71 g/mol. Its IUPAC name is 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine.
Molecular Properties
| Compound Name | 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine |
| PubChem CID | 63402001 |
| Molecular Formula | C8H8ClN5S |
| Molecular Weight | 241.71 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine |
| SMILES | Cc1nnc(Sc2nccnc2Cl)n1C |
| InChI | InChI=1S/C8H8ClN5S/c1-5-12-13-8(14(5)2)15-7-6(9)10-3-4-11-7/h3-4H,1-2H3 |
| InChIKey | IBMZCPDPJBHOEV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.71 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine?
The IUPAC name of 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine (CID 63402001) is 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine.
What is the SMILES notation for 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine?
The canonical SMILES for 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine is Cc1nnc(Sc2nccnc2Cl)n1C.
What is the InChIKey of 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine?
The InChIKey is IBMZCPDPJBHOEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN5S/c1-5-12-13-8(14(5)2)15-7-6(9)10-3-4-11-7/h3-4H,1-2H3.
What are the key properties of 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine?
2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine has a molecular weight of 241.71 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine is sourced from PubChem (CID 63402001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).